CAS 1306738-79-3 is the registry number for 5-(1-Bromoethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(1-bromoethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole (CAS 1306738-79-3) is a chemical compound with the molecular formula C5H4BrF3N2O and a molecular weight of 245.00 g/mol. IUPAC name: 5-(1-bromoethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole. InChIKey: XVZLXGWSJWBPRB-UHFFFAOYSA-N.
| Molecular formula | C5H4BrF3N2O |
|---|---|
| Molecular weight | 245.00 g/mol |
| IUPAC name | 5-(1-bromoethyl)-3-(trifluoromethyl)-1,2,4-oxadiazole |
| InChIKey | XVZLXGWSJWBPRB-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=NO1)C(F)(F)F)Br |
Computed by PubChem (NCBI)