CAS 1542813-56-8 is the registry number for 4-Bromo-1-methyl-3-(trifluoromethyl)-4,5-dihydro-1H-pyrazol-5-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-2-methyl-5-(trifluoromethyl)-4H-pyrazol-3-one (CAS 1542813-56-8) is a chemical compound with the molecular formula C5H4BrF3N2O and a molecular weight of 245.00 g/mol. IUPAC name: 4-bromo-2-methyl-5-(trifluoromethyl)-4H-pyrazol-3-one. InChIKey: SCJJHLMKNIKQGJ-UHFFFAOYSA-N.
| Molecular formula | C5H4BrF3N2O |
|---|---|
| Molecular weight | 245.00 g/mol |
| IUPAC name | 4-bromo-2-methyl-5-(trifluoromethyl)-4H-pyrazol-3-one |
| InChIKey | SCJJHLMKNIKQGJ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(C(=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)