CAS 1307296-38-3 is the registry number for 6-O-Trityl-1,2,3,4-Tetra-O-acetyl-D-mannopyranose. Offered by: Biosynth. Available pack sizes: 5000mg, 2000mg, 10000mg.
[(2R,3R,4S,5S)-4,5,6-triacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate (CAS 1307296-38-3) is a chemical compound with the molecular formula C33H34O10 and a molecular weight of 590.6 g/mol. IUPAC name: [(2R,3R,4S,5S)-4,5,6-triacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate. InChIKey: GTJGUFOLNHYRQE-BJPJELPDSA-N.
| Molecular formula | C33H34O10 |
|---|---|
| Molecular weight | 590.6 g/mol |
| IUPAC name | [(2R,3R,4S,5S)-4,5,6-triacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate |
| InChIKey | GTJGUFOLNHYRQE-BJPJELPDSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](OC([C@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C)COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)