CAS 72691-30-6 is the registry number for 1,2,3,4-Tetra-O-acetyl-6-O-trityl-a-D-mannopyranose. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg.
[(2R,3R,4S,5S,6R)-4,5,6-triacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate (CAS 72691-30-6) is a chemical compound with the molecular formula C33H34O10 and a molecular weight of 590.6 g/mol. IUPAC name: [(2R,3R,4S,5S,6R)-4,5,6-triacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate. InChIKey: GTJGUFOLNHYRQE-KQLGDFJMSA-N.
| Molecular formula | C33H34O10 |
|---|---|
| Molecular weight | 590.6 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6R)-4,5,6-triacetyloxy-2-(trityloxymethyl)oxan-3-yl] acetate |
| InChIKey | GTJGUFOLNHYRQE-KQLGDFJMSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](O[C@@H]([C@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C)COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)