CAS 130800-83-8 appears in our catalog under these names: 1-(Bromomethyl)-2,3,5-trichlorobenzene, 95+%, 2,3,5-Trichlorobenzyl bromide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(bromomethyl)-2,3,5-trichlorobenzene (CAS 130800-83-8) is a chemical compound with the molecular formula C7H4BrCl3 and a molecular weight of 274.4 g/mol. IUPAC name: 1-(bromomethyl)-2,3,5-trichlorobenzene. InChIKey: IPFQCETYZRPQAM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl3 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 1-(bromomethyl)-2,3,5-trichlorobenzene |
| InChIKey | IPFQCETYZRPQAM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CBr)Cl)Cl)Cl |
Computed by PubChem (NCBI)