CAS 4960-48-9 is the registry number for 2-(Bromomethyl)-1,3,4-trichlorobenzene, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(bromomethyl)-1,3,4-trichlorobenzene (CAS 4960-48-9) is a chemical compound with the molecular formula C7H4BrCl3 and a molecular weight of 274.4 g/mol. IUPAC name: 2-(bromomethyl)-1,3,4-trichlorobenzene. InChIKey: URKUOLGHTOGYJL-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl3 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 2-(bromomethyl)-1,3,4-trichlorobenzene |
| InChIKey | URKUOLGHTOGYJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CBr)Cl)Cl |
Computed by PubChem (NCBI)