CAS 130825-16-0 appears in our catalog under these names: (2,4-Dichloropyrimidin-5-yl)(phenyl)methanol, 95%, (2,4-Dichloropyrimidin-5-yl)(phenyl)methanol, 97%, (2,4–Dichloropyrimidin–5–yl)(phenyl)methanol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2,4-dichloropyrimidin-5-yl)-phenylmethanol (CAS 130825-16-0) is a chemical compound with the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. IUPAC name: (2,4-dichloropyrimidin-5-yl)-phenylmethanol. InChIKey: PEBHDUCCKONWJE-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | (2,4-dichloropyrimidin-5-yl)-phenylmethanol |
| InChIKey | PEBHDUCCKONWJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CN=C(N=C2Cl)Cl)O |
Computed by PubChem (NCBI)