CAS 849021-00-7 is the registry number for 5-Chloro-6-(3-chlorophenyl)-2-methylpyridazin-3(2h)-one, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
5-chloro-6-(3-chlorophenyl)-2-methylpyridazin-3-one (CAS 849021-00-7) is a chemical compound with the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. IUPAC name: 5-chloro-6-(3-chlorophenyl)-2-methylpyridazin-3-one. InChIKey: VMVNHTWTVARXAO-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 5-chloro-6-(3-chlorophenyl)-2-methylpyridazin-3-one |
| InChIKey | VMVNHTWTVARXAO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(C(=N1)C2=CC(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)