CAS 130840-21-0 appears in our catalog under these names: 1-(2-Bromoethoxy)-4-methanesulfonylbenzene, 95%, 1-(2-Bromoethoxy)-4-methanesulfonylbenzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(2-bromoethoxy)-4-methylsulfonylbenzene (CAS 130840-21-0) is a chemical compound with the molecular formula C9H11BrO3S and a molecular weight of 279.15 g/mol. IUPAC name: 1-(2-bromoethoxy)-4-methylsulfonylbenzene. InChIKey: VELQWDGGOAIBKB-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3S |
|---|---|
| Molecular weight | 279.15 g/mol |
| IUPAC name | 1-(2-bromoethoxy)-4-methylsulfonylbenzene |
| InChIKey | VELQWDGGOAIBKB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)OCCBr |
Computed by PubChem (NCBI)