CAS 219945-37-6 appears in our catalog under these names: Propan-2-yl 2-bromobenzene-1-sulfonate, 95%, Propan-2-yl 2-bromobenzene-1-sulfonate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Propan-2-yl 2-bromobenzenesulfonate (CAS 219945-37-6) is a chemical compound with the molecular formula C9H11BrO3S and a molecular weight of 279.15 g/mol. IUPAC name: propan-2-yl 2-bromobenzenesulfonate. InChIKey: AISPPKSSOLMHOC-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3S |
|---|---|
| Molecular weight | 279.15 g/mol |
| IUPAC name | propan-2-yl 2-bromobenzenesulfonate |
| InChIKey | AISPPKSSOLMHOC-UHFFFAOYSA-N |
| SMILES | CC(C)OS(=O)(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)