Products 1308567-17-0
CAS 1308567-17-0 is the registry number for 4,6-Dimethyl-2-{((3-methyl-1,2-oxazol-5-yl)methyl)sulfanyl}pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,6-dimethyl-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyridine-3-carboxylic acid (CAS 1308567-17-0) is a chemical compound with the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. IUPAC name: 4,6-dimethyl-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyridine-3-carboxylic acid. InChIKey: YGSRJVPBJWFKTR-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 4,6-dimethyl-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyridine-3-carboxylic acid |
| InChIKey | YGSRJVPBJWFKTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)O)SCC2=CC(=NO2)C)C |
Computed by PubChem (NCBI)