CAS 927993-42-8 appears in our catalog under these names: 2-[(4-Methoxybenzyl)amino]-4-methyl-1,3-thiazole-5-carboxylic acid, 95%, 2-((4-Methoxybenzyl)amino)-4-methylthiazole-5-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-[(4-methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 927993-42-8) is a chemical compound with the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: YQXJVEMIWVAHHT-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | YQXJVEMIWVAHHT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NCC2=CC=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)