CAS 380626-32-4 appears in our catalog under these names: Ethyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate, 95%, ethyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate, 98%, Ethyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg, 500mg.
Ethyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate (CAS 380626-32-4) is a chemical compound with the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. IUPAC name: ethyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate. InChIKey: YHJVTNQLQOBMRK-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | ethyl 2-amino-4-(4-methoxyphenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | YHJVTNQLQOBMRK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)