Products 130861-68-6

CAS 130861-68-6 is the registry number for 2-Bromo-5,6,7,8-tetrahydroquinolin-8-yl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2-bromo-5,6,7,8-tetrahydroquinolin-8-yl) acetate (CAS 130861-68-6) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: (2-bromo-5,6,7,8-tetrahydroquinolin-8-yl) acetate. InChIKey: LHNTWXOETYKIPH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12BrNO2
Molecular weight270.12 g/mol
IUPAC name(2-bromo-5,6,7,8-tetrahydroquinolin-8-yl) acetate
InChIKeyLHNTWXOETYKIPH-UHFFFAOYSA-N
SMILESCC(=O)OC1CCCC2=C1N=C(C=C2)Br

Computed by PubChem (NCBI)