CAS 130881-11-7 is the registry number for ((Trifluoromethyl)sulfonyl)-L-valine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-methyl-2-(trifluoromethylsulfonylamino)butanoic acid (CAS 130881-11-7) is a chemical compound with the molecular formula C6H10F3NO4S and a molecular weight of 249.21 g/mol. IUPAC name: (2S)-3-methyl-2-(trifluoromethylsulfonylamino)butanoic acid. InChIKey: UJMLUEWCAMFOKZ-BYPYZUCNSA-N.
| Molecular formula | C6H10F3NO4S |
|---|---|
| Molecular weight | 249.21 g/mol |
| IUPAC name | (2S)-3-methyl-2-(trifluoromethylsulfonylamino)butanoic acid |
| InChIKey | UJMLUEWCAMFOKZ-BYPYZUCNSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)