CAS 1610799-82-0 appears in our catalog under these names: (2E)-3-methanesulfonylprop-2-en-1-amine trifluoroacetic acid, 95%, (E)-3-(Methylsulfonyl)prop-2-en-1-amine 2,2,2-trifluoroacetate, 97%, 3-Methanesulfonylprop-2-en-1-amine trifluoroacetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 0,5g, 50mg.
(E)-3-methylsulfonylprop-2-en-1-amine;2,2,2-trifluoroacetic acid (CAS 1610799-82-0) is a chemical compound with the molecular formula C6H10F3NO4S and a molecular weight of 249.21 g/mol. IUPAC name: (E)-3-methylsulfonylprop-2-en-1-amine;2,2,2-trifluoroacetic acid. InChIKey: BQUJESSFPJRFCW-VEELZWTKSA-N.
| Molecular formula | C6H10F3NO4S |
|---|---|
| Molecular weight | 249.21 g/mol |
| IUPAC name | (E)-3-methylsulfonylprop-2-en-1-amine;2,2,2-trifluoroacetic acid |
| InChIKey | BQUJESSFPJRFCW-VEELZWTKSA-N |
| SMILES | CS(=O)(=O)/C=C/CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)