Products 1308914-90-0
CAS 1308914-90-0 appears in our catalog under these names: 2-(4-Isopropylphenyl)pyridin-3-amine, 95%, 2–(4–Isopropylphenyl)pyridin–3–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-(4-propan-2-ylphenyl)pyridin-3-amine (CAS 1308914-90-0) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)pyridin-3-amine. InChIKey: HAFGXKKLTSXJPK-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)pyridin-3-amine |
| InChIKey | HAFGXKKLTSXJPK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=C(C=CC=N2)N |
Computed by PubChem (NCBI)