Products 1309283-15-5
CAS 1309283-15-5 is the registry number for Dapivirine-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,5,6-tetradeuterio-4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile (CAS 1309283-15-5) is a chemical compound with the molecular formula C20H19N5 and a molecular weight of 333.4 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile. InChIKey: ILAYIAGXTHKHNT-UGWFXTGHSA-N.
| Molecular formula | C20H19N5 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile |
| InChIKey | ILAYIAGXTHKHNT-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C#N)[2H])[2H])NC2=NC=CC(=N2)NC3=C(C=C(C=C3C)C)C)[2H] |
Computed by PubChem (NCBI)