CAS 244767-67-7 appears in our catalog under these names: Dapivirine, >95% (HPLC), Dapivirine (TMC120), Dapivirine, Dapivirine, >97.0%(HPLC)(T), Dapivirine, 98%. Offered by: TRC, GLPBio, TargetMol, Biosynth, TCI. Available pack sizes: 10mg, 25mg, 5mg, 100mg, 10mM (in 1ml dmso), 50mg, 2mg, 250mg.
4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile (CAS 244767-67-7) is a chemical compound with the molecular formula C20H19N5 and a molecular weight of 329.4 g/mol. IUPAC name: 4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile. InChIKey: ILAYIAGXTHKHNT-UHFFFAOYSA-N.
| Molecular formula | C20H19N5 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile |
| InChIKey | ILAYIAGXTHKHNT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=NC(=NC=C2)NC3=CC=C(C=C3)C#N)C |
Computed by PubChem (NCBI)