Products 1309593-24-5
CAS 1309593-24-5 is the registry number for Mps-BAY1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[2-(2-cyanoanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]-2-phenylacetamide (CAS 1309593-24-5) is a chemical compound with the molecular formula C27H20N6O and a molecular weight of 444.5 g/mol. IUPAC name: N-[4-[2-(2-cyanoanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]-2-phenylacetamide. InChIKey: RPGJGJRXGBZPLW-UHFFFAOYSA-N.
| Molecular formula | C27H20N6O |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | N-[4-[2-(2-cyanoanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]-2-phenylacetamide |
| InChIKey | RPGJGJRXGBZPLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=CC=C(C=C2)C3=CN4C(=NC(=N4)NC5=CC=CC=C5C#N)C=C3 |
Computed by PubChem (NCBI)
Synonyms:
Mps-BAY1, orb2665283