CAS 53859-71-5 is the registry number for N,N'–Bis(4–(1H–benzimidazol–2–yl)phenyl)urea. Offered by: GLPBio. Available pack sizes: 10mg.
1,3-bis[4-(1H-benzimidazol-2-yl)phenyl]urea (CAS 53859-71-5) is a chemical compound with the molecular formula C27H20N6O and a molecular weight of 444.5 g/mol. IUPAC name: 1,3-bis[4-(1H-benzimidazol-2-yl)phenyl]urea. InChIKey: BQLOPROPJDPFEX-UHFFFAOYSA-N.
| Molecular formula | C27H20N6O |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | 1,3-bis[4-(1H-benzimidazol-2-yl)phenyl]urea |
| InChIKey | BQLOPROPJDPFEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=CC=C(C=C3)NC(=O)NC4=CC=C(C=C4)C5=NC6=CC=CC=C6N5 |
Computed by PubChem (NCBI)