CAS 1309601-54-4 appears in our catalog under these names: N3,N3,N6,N6-Tetramethyl-9H-carbazole-3,6-diamine, 98%, N3,N3,N6,N6-Tetramethyl-9H-carbazole-3,6-diamine 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
3-N,3-N,6-N,6-N-tetramethyl-9H-carbazole-3,6-diamine (CAS 1309601-54-4) is a chemical compound with the molecular formula C16H19N3 and a molecular weight of 253.34 g/mol. IUPAC name: 3-N,3-N,6-N,6-N-tetramethyl-9H-carbazole-3,6-diamine. InChIKey: WRRDGZBKMQHXGG-UHFFFAOYSA-N.
| Molecular formula | C16H19N3 |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 3-N,3-N,6-N,6-N-tetramethyl-9H-carbazole-3,6-diamine |
| InChIKey | WRRDGZBKMQHXGG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)NC3=C2C=C(C=C3)N(C)C |
Computed by PubChem (NCBI)