Products 53877-42-2

CAS 53877-42-2 is the registry number for Mefenamic Acid Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(2,3-dimethylphenyl)diazenyl]-2,3-dimethylaniline (CAS 53877-42-2) is a chemical compound with the molecular formula C16H19N3 and a molecular weight of 253.34 g/mol. IUPAC name: 4-[(2,3-dimethylphenyl)diazenyl]-2,3-dimethylaniline. InChIKey: KYCNSLAIMRPJIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19N3
Molecular weight253.34 g/mol
IUPAC name4-[(2,3-dimethylphenyl)diazenyl]-2,3-dimethylaniline
InChIKeyKYCNSLAIMRPJIZ-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)N=NC2=C(C(=C(C=C2)N)C)C)C

Computed by PubChem (NCBI)