CAS 53877-42-2 is the registry number for Mefenamic Acid Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2,3-dimethylphenyl)diazenyl]-2,3-dimethylaniline (CAS 53877-42-2) is a chemical compound with the molecular formula C16H19N3 and a molecular weight of 253.34 g/mol. IUPAC name: 4-[(2,3-dimethylphenyl)diazenyl]-2,3-dimethylaniline. InChIKey: KYCNSLAIMRPJIZ-UHFFFAOYSA-N.
| Molecular formula | C16H19N3 |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | 4-[(2,3-dimethylphenyl)diazenyl]-2,3-dimethylaniline |
| InChIKey | KYCNSLAIMRPJIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N=NC2=C(C(=C(C=C2)N)C)C)C |
Computed by PubChem (NCBI)