Products 1309935-98-5

CAS 1309935-98-5 is the registry number for 6-Sulfatoxy Melatonin-d4. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5mg, 1mg.

Structural formula: {0} (CAS {1})

[3-(2-acetamido-1,1,2,2-tetradeuterioethyl)-5-methoxy-1H-indol-6-yl] hydrogen sulfate (CAS 1309935-98-5) is a chemical compound with the molecular formula C13H16N2O6S and a molecular weight of 332.37 g/mol. IUPAC name: [3-(2-acetamido-1,1,2,2-tetradeuterioethyl)-5-methoxy-1H-indol-6-yl] hydrogen sulfate. InChIKey: QQEILXDLZRLTME-KHORGVISSA-N.

Identity
Molecular formulaC13H16N2O6S
Molecular weight332.37 g/mol
IUPAC name[3-(2-acetamido-1,1,2,2-tetradeuterioethyl)-5-methoxy-1H-indol-6-yl] hydrogen sulfate
InChIKeyQQEILXDLZRLTME-KHORGVISSA-N
SMILES[2H]C([2H])(C1=CNC2=CC(=C(C=C21)OC)OS(=O)(=O)O)C([2H])([2H])NC(=O)C

Computed by PubChem (NCBI)