CAS 1309935-98-5 is the registry number for 6-Sulfatoxy Melatonin-d4. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5mg, 1mg.
[3-(2-acetamido-1,1,2,2-tetradeuterioethyl)-5-methoxy-1H-indol-6-yl] hydrogen sulfate (CAS 1309935-98-5) is a chemical compound with the molecular formula C13H16N2O6S and a molecular weight of 332.37 g/mol. IUPAC name: [3-(2-acetamido-1,1,2,2-tetradeuterioethyl)-5-methoxy-1H-indol-6-yl] hydrogen sulfate. InChIKey: QQEILXDLZRLTME-KHORGVISSA-N.
| Molecular formula | C13H16N2O6S |
|---|---|
| Molecular weight | 332.37 g/mol |
| IUPAC name | [3-(2-acetamido-1,1,2,2-tetradeuterioethyl)-5-methoxy-1H-indol-6-yl] hydrogen sulfate |
| InChIKey | QQEILXDLZRLTME-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=CC(=C(C=C21)OC)OS(=O)(=O)O)C([2H])([2H])NC(=O)C |
Computed by PubChem (NCBI)