CAS 712344-24-6 appears in our catalog under these names: N-(4-(Morpholin-4-ylsulfonyl)benzoyl)glycine, 95%, N-[4-(Morpholin-4-ylsulfonyl)benzoyl]glycine. Offered by: AmBeed, MedChemExpress. Available pack sizes: 10g, 5g, Get quote.
2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]acetic acid (CAS 712344-24-6) is a chemical compound with the molecular formula C13H16N2O6S and a molecular weight of 328.34 g/mol. IUPAC name: 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]acetic acid. InChIKey: RDWZKCANUFCXOP-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O6S |
|---|---|
| Molecular weight | 328.34 g/mol |
| IUPAC name | 2-[(4-morpholin-4-ylsulfonylbenzoyl)amino]acetic acid |
| InChIKey | RDWZKCANUFCXOP-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)