Products 1310012-16-8
CAS 1310012-16-8 appears in our catalog under these names: Bisoprolol-d7 Hemifumarate, >95% (HPLC), (±)-Bisoprolol-d7 Hemifumarate (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, Bisoprolol-d7. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 1 mg, 10 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propan-2-ol (CAS 1310012-16-8) is a chemical compound with the molecular formula C18H31NO4 and a molecular weight of 332.5 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propan-2-ol. InChIKey: VHYCDWMUTMEGQY-HSNISVEUSA-N.
| Molecular formula | C18H31NO4 |
|---|---|
| Molecular weight | 332.5 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]propan-2-ol |
| InChIKey | VHYCDWMUTMEGQY-HSNISVEUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)COCCOC(C)C)O |
Computed by PubChem (NCBI)