CAS 1447715-44-7 appears in our catalog under these names: Bisoprolol EP Impurity B, Bisoprolol Impurity 2(Bisoprolol EP Impurity B), O-Desisopropyl O-Propyl Bisoprolol, (RS)-1-Isopropylamino-3-(4-(2-propoxyethoxymethyl)phenoxy)propan-2-ol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
1-(propan-2-ylamino)-3-[4-(2-propoxyethoxymethyl)phenoxy]propan-2-ol (CAS 1447715-44-7) is a chemical compound with the molecular formula C18H31NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 1-(propan-2-ylamino)-3-[4-(2-propoxyethoxymethyl)phenoxy]propan-2-ol. InChIKey: QQQJXQPOCNDBDS-UHFFFAOYSA-N.
| Molecular formula | C18H31NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 1-(propan-2-ylamino)-3-[4-(2-propoxyethoxymethyl)phenoxy]propan-2-ol |
| InChIKey | QQQJXQPOCNDBDS-UHFFFAOYSA-N |
| SMILES | CCCOCCOCC1=CC=C(C=C1)OCC(CNC(C)C)O |
Computed by PubChem (NCBI)