CAS 1310049-89-8 is the registry number for N-[4-(4-Bromophenyl)-2-thiazolyl]-6-methyl-2-pyridinamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4-bromophenyl)-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine (CAS 1310049-89-8) is a chemical compound with the molecular formula C15H12BrN3S and a molecular weight of 346.2 g/mol. IUPAC name: 4-(4-bromophenyl)-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine. InChIKey: VPSJTTNJJCQXLE-UHFFFAOYSA-N.
| Molecular formula | C15H12BrN3S |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 4-(4-bromophenyl)-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine |
| InChIKey | VPSJTTNJJCQXLE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC2=NC(=CS2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)