CAS 13102-34-6 is the registry number for 2-(2,5-Dichlorophenyl)-5-methyl-2,4-dihydro-3h-pyrazol-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,5-dichlorophenyl)-5-methyl-4H-pyrazol-3-one (CAS 13102-34-6) is a chemical compound with the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)-5-methyl-4H-pyrazol-3-one. InChIKey: FCWUFSJRTXLBTH-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2O |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)-5-methyl-4H-pyrazol-3-one |
| InChIKey | FCWUFSJRTXLBTH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)