CAS 338959-93-6 is the registry number for (3E)-3-([(2,4-Dichlorophenyl)methoxy]imino)propanenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3E)-3-[(2,4-dichlorophenyl)methoxyimino]propanenitrile (CAS 338959-93-6) is a chemical compound with the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. IUPAC name: (3E)-3-[(2,4-dichlorophenyl)methoxyimino]propanenitrile. InChIKey: SIPLJZFYZXUOMT-LHHJGKSTSA-N.
| Molecular formula | C10H8Cl2N2O |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | (3E)-3-[(2,4-dichlorophenyl)methoxyimino]propanenitrile |
| InChIKey | SIPLJZFYZXUOMT-LHHJGKSTSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CO/N=C/CC#N |
Computed by PubChem (NCBI)