CAS 1310383-58-4 is the registry number for 5-Chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
5-chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1310383-58-4) is a chemical compound with the molecular formula C11H14BClFNO2 and a molecular weight of 257.50 g/mol. IUPAC name: 5-chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: LBHNCAMAHMVBTE-UHFFFAOYSA-N.
| Molecular formula | C11H14BClFNO2 |
|---|---|
| Molecular weight | 257.50 g/mol |
| IUPAC name | 5-chloro-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | LBHNCAMAHMVBTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2Cl)F |
Computed by PubChem (NCBI)