Products 1310384-34-9

CAS 1310384-34-9 appears in our catalog under these names: 5-Aminopyridine-3-boronic acid hydrochloride, 95%, (5-Aminopyridin-3-yl)boronic acid hydrochloride, 98+%, (5-Aminopyridin-3-yl)boronic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

(5-amino-3-pyridinyl)boronic acid;hydrochloride (CAS 1310384-34-9) is a chemical compound with the molecular formula C5H8BClN2O2 and a molecular weight of 174.39 g/mol. IUPAC name: (5-amino-3-pyridinyl)boronic acid;hydrochloride. InChIKey: FFNXDGUUZKYZGR-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8BClN2O2
Molecular weight174.39 g/mol
IUPAC name(5-amino-3-pyridinyl)boronic acid;hydrochloride
InChIKeyFFNXDGUUZKYZGR-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1)N)(O)O.Cl

Computed by PubChem (NCBI)