Products 959904-53-1

CAS 959904-53-1 appears in our catalog under these names: B-(4-Amino-3-pyridinyl)-boronic acid hydrochloride, 95%, (4-aminopyridin-3-yl)boronic acid hydrochloride, (4-Aminopyridin-3-yl)boronic acid hydrochloride 97%, 4-aminopyridin-3-ylboronic acid hydrochloride, 97%, 97%, (4-amino-3-pyridinyl)boronic acid hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 2,5g.

Structural formula: {0} (CAS {1})

(4-amino-3-pyridinyl)boronic acid;hydrochloride (CAS 959904-53-1) is a chemical compound with the molecular formula C5H8BClN2O2 and a molecular weight of 174.39 g/mol. IUPAC name: (4-amino-3-pyridinyl)boronic acid;hydrochloride. InChIKey: UWTNNCFLQICMEL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8BClN2O2
Molecular weight174.39 g/mol
IUPAC name(4-amino-3-pyridinyl)boronic acid;hydrochloride
InChIKeyUWTNNCFLQICMEL-UHFFFAOYSA-N
SMILESB(C1=C(C=CN=C1)N)(O)O.Cl

Computed by PubChem (NCBI)