Products 1310404-27-3
CAS 1310404-27-3 is the registry number for 2-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. Offered by: TRC. Available pack sizes: 500mg.
2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1310404-27-3) is a chemical compound with the molecular formula C10H14BClN2O2 and a molecular weight of 240.50 g/mol. IUPAC name: 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: QQSUAGFVCYBRDH-UHFFFAOYSA-N.
| Molecular formula | C10H14BClN2O2 |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | QQSUAGFVCYBRDH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)