CAS 2223039-21-0 is the registry number for 4-Chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 2223039-21-0) is a chemical compound with the molecular formula C10H14BClN2O2 and a molecular weight of 240.50 g/mol. IUPAC name: 4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: UVUDAPWIZZMUAC-UHFFFAOYSA-N.
| Molecular formula | C10H14BClN2O2 |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | 4-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | UVUDAPWIZZMUAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CN=C2Cl |
Computed by PubChem (NCBI)