CAS 1310455-86-7 appears in our catalog under these names: GNF179 Metabolite, GNF179 (Metabolite), 98+%, 2-(4-Fluorophenyl)-8,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine 95%, GNF179 (Metabolite), GNF179 Metabolite-13C2. Offered by: Chemat Brand, AmBeed, MedChemExpress. Available pack sizes: on request, 1g, 250mg, 5mg, 10mg, 25mg, 50mg, 100mg.
2-(4-fluorophenyl)-8,8-dimethyl-6,7-dihydro-5H-imidazo[1,2-a]pyrazine (CAS 1310455-86-7) is a chemical compound with the molecular formula C14H16FN3 and a molecular weight of 245.29 g/mol. IUPAC name: 2-(4-fluorophenyl)-8,8-dimethyl-6,7-dihydro-5H-imidazo[1,2-a]pyrazine. InChIKey: GZVLWGZMELYUPG-UHFFFAOYSA-N.
| Molecular formula | C14H16FN3 |
|---|---|
| Molecular weight | 245.29 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-8,8-dimethyl-6,7-dihydro-5H-imidazo[1,2-a]pyrazine |
| InChIKey | GZVLWGZMELYUPG-UHFFFAOYSA-N |
| SMILES | CC1(C2=NC(=CN2CCN1)C3=CC=C(C=C3)F)C |
Computed by PubChem (NCBI)