CAS 2097360-79-5 is the registry number for (R)-1-(2-Fluoro-5-methylphenyl)-4,5,6,7-tetrahydro-1H-indazol-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-1-(2-fluoro-5-methylphenyl)-4,5,6,7-tetrahydroindazol-4-amine (CAS 2097360-79-5) is a chemical compound with the molecular formula C14H16FN3 and a molecular weight of 245.29 g/mol. IUPAC name: (4R)-1-(2-fluoro-5-methylphenyl)-4,5,6,7-tetrahydroindazol-4-amine. InChIKey: VAKJTZYZELKJKG-GFCCVEGCSA-N.
| Molecular formula | C14H16FN3 |
|---|---|
| Molecular weight | 245.29 g/mol |
| IUPAC name | (4R)-1-(2-fluoro-5-methylphenyl)-4,5,6,7-tetrahydroindazol-4-amine |
| InChIKey | VAKJTZYZELKJKG-GFCCVEGCSA-N |
| SMILES | CC1=CC(=C(C=C1)F)N2C3=C(C=N2)[C@@H](CCC3)N |
Computed by PubChem (NCBI)