CAS 1310680-49-9 appears in our catalog under these names: Fmoc-3-amino-2,2-difluoro-propionic acid, 95%, Fmoc-3-amino-2,2-difluoro-propionic acid, 97%, Fmoc-beta-Ala(F2)-OH, 3-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)-2,2-difluoropropanoic acid. Offered by: Combi-blocks, AmBeed, Iris Biotech, Biosynth. Available pack sizes: 1g, 2g, 100mg, 250mg, 5g, 0,5g, 50mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-difluoropropanoic acid (CAS 1310680-49-9) is a chemical compound with the molecular formula C18H15F2NO4 and a molecular weight of 347.3 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-difluoropropanoic acid. InChIKey: HOZFQTTWTYZFHA-UHFFFAOYSA-N.
| Molecular formula | C18H15F2NO4 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-difluoropropanoic acid |
| InChIKey | HOZFQTTWTYZFHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(C(=O)O)(F)F |
Computed by PubChem (NCBI)