CAS 1784748-66-8 is the registry number for Rel-(3R,4S)-4-(4-(benzyloxy)-2,6-difluorophenyl)-2-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-(2,6-difluoro-4-phenylmethoxyphenyl)-2-oxopyrrolidine-3-carboxylic acid (CAS 1784748-66-8) is a chemical compound with the molecular formula C18H15F2NO4 and a molecular weight of 347.3 g/mol. IUPAC name: (3R,4S)-4-(2,6-difluoro-4-phenylmethoxyphenyl)-2-oxopyrrolidine-3-carboxylic acid. InChIKey: WWTKHTZWKABYDL-MLGOLLRUSA-N.
| Molecular formula | C18H15F2NO4 |
|---|---|
| Molecular weight | 347.3 g/mol |
| IUPAC name | (3R,4S)-4-(2,6-difluoro-4-phenylmethoxyphenyl)-2-oxopyrrolidine-3-carboxylic acid |
| InChIKey | WWTKHTZWKABYDL-MLGOLLRUSA-N |
| SMILES | C1[C@@H]([C@H](C(=O)N1)C(=O)O)C2=C(C=C(C=C2F)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)