CAS 1310907-71-1 is the registry number for TU-100. Offered by: MedChemExpress. Available pack sizes: Get quote.
20-methyl-20-azapentacyclo[10.7.1.02,11.04,9.013,18]icosa-2(11),4,6,8,13,15,17-heptaene-3,10,19-trione (CAS 1310907-71-1) is a chemical compound with the molecular formula C20H13NO3 and a molecular weight of 315.3 g/mol. IUPAC name: 20-methyl-20-azapentacyclo[10.7.1.02,11.04,9.013,18]icosa-2(11),4,6,8,13,15,17-heptaene-3,10,19-trione. InChIKey: KAYRGFYBCCETPE-UHFFFAOYSA-N.
| Molecular formula | C20H13NO3 |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 20-methyl-20-azapentacyclo[10.7.1.02,11.04,9.013,18]icosa-2(11),4,6,8,13,15,17-heptaene-3,10,19-trione |
| InChIKey | KAYRGFYBCCETPE-UHFFFAOYSA-N |
| SMILES | CN1C2C3=CC=CC=C3C(=O)C1C4=C2C(=O)C5=CC=CC=C5C4=O |
Computed by PubChem (NCBI)