Products 906440-37-7
CAS 906440-37-7 appears in our catalog under these names: SMBA 1, SMBA1, SMBA 1, SMBA1, 99.5800%, SMBA 1, 98%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 50mg, 1mg, 5mg, 25mg, 100mg, 500mg, 50 mg.
2-[(Z)-(2-nitrofluoren-9-ylidene)methyl]phenol (CAS 906440-37-7) is a chemical compound with the molecular formula C20H13NO3 and a molecular weight of 315.3 g/mol. IUPAC name: 2-[(Z)-(2-nitrofluoren-9-ylidene)methyl]phenol. InChIKey: PEYKRJBXACUOOB-WQRHYEAKSA-N.
| Molecular formula | C20H13NO3 |
|---|---|
| Molecular weight | 315.3 g/mol |
| IUPAC name | 2-[(Z)-(2-nitrofluoren-9-ylidene)methyl]phenol |
| InChIKey | PEYKRJBXACUOOB-WQRHYEAKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C\2/C3=CC=CC=C3C4=C2C=C(C=C4)[N+](=O)[O-])O |
Computed by PubChem (NCBI)