Products 1311147-30-4
CAS 1311147-30-4 is the registry number for Methyl (1S,3S)-3-amino-1-methylcyclopentane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-methyl (1S,3S)-3-amino-1-methylcyclopentane-1-carboxylate (CAS 1311147-30-4) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: cis-methyl (1S,3S)-3-amino-1-methylcyclopentane-1-carboxylate. InChIKey: DYXKGUVHXWEDTR-XPUUQOCRSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | cis-methyl (1S,3S)-3-amino-1-methylcyclopentane-1-carboxylate |
| InChIKey | DYXKGUVHXWEDTR-XPUUQOCRSA-N |
| SMILES | C[C@@]1(CC[C@@H](C1)N)C(=O)OC |
Computed by PubChem (NCBI)