CAS 1311315-95-3 is the registry number for 5-(4-Nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(4-nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride (CAS 1311315-95-3) is a chemical compound with the molecular formula C15H14ClN3O2S and a molecular weight of 335.8 g/mol. IUPAC name: 5-(4-nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride. InChIKey: ZTAXNJFDNWKPOR-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O2S |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-N-phenyl-4,5-dihydro-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | ZTAXNJFDNWKPOR-UHFFFAOYSA-N |
| SMILES | C1C(SC(=N1)NC2=CC=CC=C2)C3=CC=C(C=C3)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)