Products 474263-21-3
CAS 474263-21-3 appears in our catalog under these names: CK2 inhibitor 4, 3-((5,6-Dimethylthieno[2,3-d]pyrimidin-4-yl)amino)benzoic acid hydrochloride, 95%. Offered by: MedChemExpress, Chemat. Available pack sizes: 250 mg, 25 mg, 50 mg, 100 mg, 5mg, 10mg, 25mg, 50mg.
3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride (CAS 474263-21-3) is a chemical compound with the molecular formula C15H14ClN3O2S and a molecular weight of 335.8 g/mol. IUPAC name: 3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride. InChIKey: RFNJVGLMWCCTDA-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O2S |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 3-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid;hydrochloride |
| InChIKey | RFNJVGLMWCCTDA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC=NC(=C12)NC3=CC=CC(=C3)C(=O)O)C.Cl |
Computed by PubChem (NCBI)