Products 1311320-25-8

CAS 1311320-25-8 is the registry number for tert-Butyl N-((2S)-2-(2-fluorophenyl)-2-hydroxyethyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2S)-2-(2-fluorophenyl)-2-hydroxyethyl]carbamate (CAS 1311320-25-8) is a chemical compound with the molecular formula C13H18FNO3 and a molecular weight of 255.28 g/mol. IUPAC name: tert-butyl N-[(2S)-2-(2-fluorophenyl)-2-hydroxyethyl]carbamate. InChIKey: SXOGEIANFSVTSL-LLVKDONJSA-N.

Identity
Molecular formulaC13H18FNO3
Molecular weight255.28 g/mol
IUPAC nametert-butyl N-[(2S)-2-(2-fluorophenyl)-2-hydroxyethyl]carbamate
InChIKeySXOGEIANFSVTSL-LLVKDONJSA-N
SMILESCC(C)(C)OC(=O)NC[C@H](C1=CC=CC=C1F)O

Computed by PubChem (NCBI)