Products 847686-72-0

CAS 847686-72-0 is the registry number for (1-(2-Fluoro-phenyl)-2-hydroxy-ethyl)-carbamic acid tert-butyl ester. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[1-(2-fluorophenyl)-2-hydroxyethyl]carbamate (CAS 847686-72-0) is a chemical compound with the molecular formula C13H18FNO3 and a molecular weight of 255.28 g/mol. IUPAC name: tert-butyl N-[1-(2-fluorophenyl)-2-hydroxyethyl]carbamate. InChIKey: MKWCLZHNMBIJAG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18FNO3
Molecular weight255.28 g/mol
IUPAC nametert-butyl N-[1-(2-fluorophenyl)-2-hydroxyethyl]carbamate
InChIKeyMKWCLZHNMBIJAG-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CO)C1=CC=CC=C1F

Computed by PubChem (NCBI)