CAS 13114-27-7 appears in our catalog under these names: Zeatin, Zeatin, >95% (HPLC), Zeatin/ 99.78% (existing batch purity), ZEATIN MIXED ISOMERS–PLANT CELL CULTURE TESTED, Zeatin mixed isomers. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 100mg, 25mg, 5mg, 1g, 250mg, 50mg, 5g.
2-methyl-4-(7H-purin-6-ylamino)but-2-en-1-ol (CAS 13114-27-7) is a chemical compound with the molecular formula C10H13N5O and a molecular weight of 219.24 g/mol. IUPAC name: 2-methyl-4-(7H-purin-6-ylamino)but-2-en-1-ol. InChIKey: UZKQTCBAMSWPJD-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2-methyl-4-(7H-purin-6-ylamino)but-2-en-1-ol |
| InChIKey | UZKQTCBAMSWPJD-UHFFFAOYSA-N |
| SMILES | CC(=CCNC1=NC=NC2=C1NC=N2)CO |
Computed by PubChem (NCBI)