CAS 72963-19-0 appears in our catalog under these names: Zeatin-d5, trans-Zeatin-d5, trans–Zeatin–d5, trans-Zeatin-d5, 99.20%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 25mg, 1mg, 500μg, 1 mg.
(E)-1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)but-2-en-1-ol (CAS 72963-19-0) is a chemical compound with the molecular formula C10H13N5O and a molecular weight of 224.27 g/mol. IUPAC name: (E)-1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)but-2-en-1-ol. InChIKey: UZKQTCBAMSWPJD-NZHOCFFMSA-N.
| Molecular formula | C10H13N5O |
|---|---|
| Molecular weight | 224.27 g/mol |
| IUPAC name | (E)-1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)but-2-en-1-ol |
| InChIKey | UZKQTCBAMSWPJD-NZHOCFFMSA-N |
| SMILES | [2H]C([2H])([2H])/C(=C\CNC1=NC=NC2=C1NC=N2)/C([2H])([2H])O |
Computed by PubChem (NCBI)