CAS 1311587-17-3 is the registry number for 5-(4-Fluorophenyl)-4-methylthiophene-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(4-fluorophenyl)-4-methylthiophene-2-carboxamide (CAS 1311587-17-3) is a chemical compound with the molecular formula C12H10FNOS and a molecular weight of 235.28 g/mol. IUPAC name: 5-(4-fluorophenyl)-4-methylthiophene-2-carboxamide. InChIKey: BNKGCFJYSNZWBX-UHFFFAOYSA-N.
| Molecular formula | C12H10FNOS |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-4-methylthiophene-2-carboxamide |
| InChIKey | BNKGCFJYSNZWBX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)C(=O)N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)