CAS 879626-93-4 is the registry number for 1-[2-(3-Fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanone (CAS 879626-93-4) is a chemical compound with the molecular formula C12H10FNOS and a molecular weight of 235.28 g/mol. IUPAC name: 1-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanone. InChIKey: GFPMIRIGJCXVQN-UHFFFAOYSA-N.
| Molecular formula | C12H10FNOS |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 1-[2-(3-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanone |
| InChIKey | GFPMIRIGJCXVQN-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=CC=C2)F)C(=O)C |
Computed by PubChem (NCBI)